C15H11NO4S — CID 121478354
ethyl 2-methyl-4,9-dioxothieno[2,3-g]quinoline-3-carboxylate (PubChem CID 121478354) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is ethyl 2-methyl-4,9-dioxothieno[2,3-g]quinoline-3-carboxylate.
| Compound Name | ethyl 2-methyl-4,9-dioxothieno[2,3-g]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 121478354 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | ethyl 2-methyl-4,9-dioxothieno[2,3-g]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)sc2c1C(=O)c1ncccc1C2=O |
| InChI | InChI=1S/C15H11NO4S/c1-3-20-15(19)9-7(2)21-14-10(9)13(18)11-8(12(14)17)5-4-6-16-11/h4-6H,3H2,1-2H3 |
| InChIKey | KNTCQCSDLITUIQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|