C14H12N2O4S — CID 25179522
ethyl (3R)-3-amino-4,9-dioxo-2H-thieno[2,3-g]quinoline-3-carboxylate (PubChem CID 25179522) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is ethyl (3R)-3-amino-4,9-dioxo-2H-thieno[2,3-g]quinoline-3-carboxylate.
| Compound Name | ethyl (3R)-3-amino-4,9-dioxo-2H-thieno[2,3-g]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 25179522 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | ethyl (3R)-3-amino-4,9-dioxo-2H-thieno[2,3-g]quinoline-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(N)CSC2=C1C(=O)c1ncccc1C2=O |
| InChI | InChI=1S/C14H12N2O4S/c1-2-20-13(19)14(15)6-21-12-8(14)11(18)9-7(10(12)17)4-3-5-16-9/h3-5H,2,6,15H2,1H3/t14-/m1/s1 |
| InChIKey | FGBQTZJYNSERFX-CQSZACIVSA-N |
| XLogP | 0.72 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|