C16H14ClNO2 — CID 14792995
ethyl 2-(5-chloroindeno[1,2-b]pyridin-5-yl)acetate (PubChem CID 14792995) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is ethyl 2-(5-chloroindeno[1,2-b]pyridin-5-yl)acetate.
| Compound Name | ethyl 2-(5-chloroindeno[1,2-b]pyridin-5-yl)acetate |
|---|---|
| PubChem CID | 14792995 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | ethyl 2-(5-chloroindeno[1,2-b]pyridin-5-yl)acetate |
| SMILES | CCOC(=O)CC1(Cl)c2ccccc2-c2ncccc21 |
| InChI | InChI=1S/C16H14ClNO2/c1-2-20-14(19)10-16(17)12-7-4-3-6-11(12)15-13(16)8-5-9-18-15/h3-9H,2,10H2,1H3 |
| InChIKey | JBXAVDFAWZHTCX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|