C15H12N2O2 — CID 19261490
ethyl 2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)acetate (PubChem CID 19261490) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is ethyl 2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)acetate.
| Compound Name | ethyl 2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)acetate |
|---|---|
| PubChem CID | 19261490 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | ethyl 2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)acetate |
| SMILES | CCOC(=O)C=C1c2cccnc2-c2ncccc21 |
| InChI | InChI=1S/C15H12N2O2/c1-2-19-13(18)9-12-10-5-3-7-16-14(10)15-11(12)6-4-8-17-15/h3-9H,2H2,1H3 |
| InChIKey | UBANHWIXQYTJCN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|