C17H21NO3 — CID 76656040
ethyl 2-[1-(2,2-dimethylpropyl)-2-oxoindol-3-ylidene]acetate (PubChem CID 76656040) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 2-[1-(2,2-dimethylpropyl)-2-oxoindol-3-ylidene]acetate.
| Compound Name | ethyl 2-[1-(2,2-dimethylpropyl)-2-oxoindol-3-ylidene]acetate |
|---|---|
| PubChem CID | 76656040 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | ethyl 2-[1-(2,2-dimethylpropyl)-2-oxoindol-3-ylidene]acetate |
| SMILES | CCOC(=O)C=C1C(=O)N(CC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H21NO3/c1-5-21-15(19)10-13-12-8-6-7-9-14(12)18(16(13)20)11-17(2,3)4/h6-10H,5,11H2,1-4H3 |
| InChIKey | IGZRAZWACCBCJM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|