C12H13NO2 — CID 146584592
ethyl (2E)-2-(6,7-dihydrocyclopenta[b]pyridin-5-ylidene)acetate (PubChem CID 146584592) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is ethyl (2E)-2-(6,7-dihydrocyclopenta[b]pyridin-5-ylidene)acetate.
| Compound Name | ethyl (2E)-2-(6,7-dihydrocyclopenta[b]pyridin-5-ylidene)acetate |
|---|---|
| PubChem CID | 146584592 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | ethyl (2E)-2-(6,7-dihydrocyclopenta[b]pyridin-5-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1\CCc2ncccc21 |
| InChI | InChI=1S/C12H13NO2/c1-2-15-12(14)8-9-5-6-11-10(9)4-3-7-13-11/h3-4,7-8H,2,5-6H2,1H3/b9-8+ |
| InChIKey | KFRCFXQHBWJIMN-CMDGGOBGSA-N |
| XLogP | 1.97 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|