C13H13BrO2 — CID 125464204
ethyl (2E)-2-(4-bromo-2,3-dihydroinden-1-ylidene)acetate (PubChem CID 125464204) has the molecular formula C13H13BrO2 and a molecular weight of 281.15 g/mol. Its IUPAC name is ethyl (2E)-2-(4-bromo-2,3-dihydroinden-1-ylidene)acetate.
| Compound Name | ethyl (2E)-2-(4-bromo-2,3-dihydroinden-1-ylidene)acetate |
|---|---|
| PubChem CID | 125464204 |
| Molecular Formula | C13H13BrO2 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | ethyl (2E)-2-(4-bromo-2,3-dihydroinden-1-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1\CCc2c(Br)cccc21 |
| InChI | InChI=1S/C13H13BrO2/c1-2-16-13(15)8-9-6-7-11-10(9)4-3-5-12(11)14/h3-5,8H,2,6-7H2,1H3/b9-8+ |
| InChIKey | VAWSQRDAHNWYMQ-CMDGGOBGSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|