C15H14Br2O3 — CID 91506031
ethyl 2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetate (PubChem CID 91506031) has the molecular formula C15H14Br2O3 and a molecular weight of 402.08 g/mol. Its IUPAC name is ethyl 2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetate.
| Compound Name | ethyl 2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetate |
|---|---|
| PubChem CID | 91506031 |
| Molecular Formula | C15H14Br2O3 |
| Molecular Weight | 402.08 g/mol |
| Exact Mass | 399.93 |
| IUPAC Name | ethyl 2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetate |
| SMILES | CCOC(=O)C=C1CCc2c(Br)c(Br)c3c(c21)CCO3 |
| InChI | InChI=1S/C15H14Br2O3/c1-2-19-11(18)7-8-3-4-9-12(8)10-5-6-20-15(10)14(17)13(9)16/h7H,2-6H2,1H3 |
| InChIKey | ZYYVTKBUADKUHM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.08 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|