C18H11BrN2O4 — CID 44567523
ethyl 10-bromo-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate (PubChem CID 44567523) has the molecular formula C18H11BrN2O4 and a molecular weight of 399.20 g/mol. Its IUPAC name is ethyl 10-bromo-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate.
| Compound Name | ethyl 10-bromo-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate |
|---|---|
| PubChem CID | 44567523 |
| Molecular Formula | C18H11BrN2O4 |
| Molecular Weight | 399.20 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | ethyl 10-bromo-5,12-dioxoindolizino[3,2-g]quinoline-11-carboxylate |
| SMILES | CCOC(=O)c1c2c(n3cccc(Br)c13)C(=O)c1cccnc1C2=O |
| InChI | InChI=1S/C18H11BrN2O4/c1-2-25-18(24)12-11-15(21-8-4-6-10(19)14(12)21)16(22)9-5-3-7-20-13(9)17(11)23/h3-8H,2H2,1H3 |
| InChIKey | NHYYOVXOARDQKV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|