C21H14F3N3O4 — CID 25181429
ethyl 2-amino-4,9-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolo[3,2-g]quinoline-3-carboxylate (PubChem CID 25181429) has the molecular formula C21H14F3N3O4 and a molecular weight of 429.35 g/mol. Its IUPAC name is ethyl 2-amino-4,9-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolo[3,2-g]quinoline-3-carboxylate.
| Compound Name | ethyl 2-amino-4,9-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolo[3,2-g]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 25181429 |
| Molecular Formula | C21H14F3N3O4 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | ethyl 2-amino-4,9-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolo[3,2-g]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c2c(n(-c3ccc(C(F)(F)F)cc3)c1N)C(=O)c1ncccc1C2=O |
| InChI | InChI=1S/C21H14F3N3O4/c1-2-31-20(30)14-13-16(18(29)15-12(17(13)28)4-3-9-26-15)27(19(14)25)11-7-5-10(6-8-11)21(22,23)24/h3-9H,2,25H2,1H3 |
| InChIKey | LCQSIBVVIHSCEC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|