C21H15F3N2O2 — CID 162680864
ethyl 5-[4-(trifluoromethyl)phenyl]pyrido[4,3-b]indole-8-carboxylate (PubChem CID 162680864) has the molecular formula C21H15F3N2O2 and a molecular weight of 384.36 g/mol. Its IUPAC name is ethyl 5-[4-(trifluoromethyl)phenyl]pyrido[4,3-b]indole-8-carboxylate.
| Compound Name | ethyl 5-[4-(trifluoromethyl)phenyl]pyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 162680864 |
| Molecular Formula | C21H15F3N2O2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | ethyl 5-[4-(trifluoromethyl)phenyl]pyrido[4,3-b]indole-8-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c1cnccc1n2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H15F3N2O2/c1-2-28-20(27)13-3-8-18-16(11-13)17-12-25-10-9-19(17)26(18)15-6-4-14(5-7-15)21(22,23)24/h3-12H,2H2,1H3 |
| InChIKey | NUOLMEUQBGOASS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |