C21H20N2O2 — CID 156597825
ethyl 5,6,11-trimethylpyrido[4,3-b]carbazole-9-carboxylate (PubChem CID 156597825) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethyl 5,6,11-trimethylpyrido[4,3-b]carbazole-9-carboxylate.
| Compound Name | ethyl 5,6,11-trimethylpyrido[4,3-b]carbazole-9-carboxylate |
|---|---|
| PubChem CID | 156597825 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | ethyl 5,6,11-trimethylpyrido[4,3-b]carbazole-9-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c1c(C)c3cnccc3c(C)c1n2C |
| InChI | InChI=1S/C21H20N2O2/c1-5-25-21(24)14-6-7-18-16(10-14)19-12(2)17-11-22-9-8-15(17)13(3)20(19)23(18)4/h6-11H,5H2,1-4H3 |
| InChIKey | MGNHVAFOJUCCIQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |