C22H27N5O2 — CID 10644296
ethyl 9-methyl-2,4-dipyrrolidin-1-ylpyrimido[4,5-b]indole-6-carboxylate (PubChem CID 10644296) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is ethyl 9-methyl-2,4-dipyrrolidin-1-ylpyrimido[4,5-b]indole-6-carboxylate.
| Compound Name | ethyl 9-methyl-2,4-dipyrrolidin-1-ylpyrimido[4,5-b]indole-6-carboxylate |
|---|---|
| PubChem CID | 10644296 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | ethyl 9-methyl-2,4-dipyrrolidin-1-ylpyrimido[4,5-b]indole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c1c(N3CCCC3)nc(N3CCCC3)nc1n2C |
| InChI | InChI=1S/C22H27N5O2/c1-3-29-21(28)15-8-9-17-16(14-15)18-19(25(17)2)23-22(27-12-6-7-13-27)24-20(18)26-10-4-5-11-26/h8-9,14H,3-7,10-13H2,1-2H3 |
| InChIKey | JMLXXPLDRVOJGR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |