C24H26N4O2 — CID 23584165
ethyl 3-(5,8-dimethylisoquinolin-6-yl)-4-(pyrrolidin-1-yldiazenyl)benzoate (PubChem CID 23584165) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is ethyl 3-(5,8-dimethylisoquinolin-6-yl)-4-(pyrrolidin-1-yldiazenyl)benzoate.
| Compound Name | ethyl 3-(5,8-dimethylisoquinolin-6-yl)-4-(pyrrolidin-1-yldiazenyl)benzoate |
|---|---|
| PubChem CID | 23584165 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | ethyl 3-(5,8-dimethylisoquinolin-6-yl)-4-(pyrrolidin-1-yldiazenyl)benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/N2CCCC2)c(-c2cc(C)c3cnccc3c2C)c1 |
| InChI | InChI=1S/C24H26N4O2/c1-4-30-24(29)18-7-8-23(26-27-28-11-5-6-12-28)21(14-18)20-13-16(2)22-15-25-10-9-19(22)17(20)3/h7-10,13-15H,4-6,11-12H2,1-3H3/b27-26+ |
| InChIKey | JPVGCVFLINZXMG-CYYJNZCTSA-N |
| XLogP | 5.79 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|