C22H24ClN3O3 — CID 102231942
ethyl 3-[(E)-3-(4-chlorophenyl)-3-hydroxyprop-1-enyl]-4-(pyrrolidin-1-yldiazenyl)benzoate (PubChem CID 102231942) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is ethyl 3-[(E)-3-(4-chlorophenyl)-3-hydroxyprop-1-enyl]-4-(pyrrolidin-1-yldiazenyl)benzoate.
| Compound Name | ethyl 3-[(E)-3-(4-chlorophenyl)-3-hydroxyprop-1-enyl]-4-(pyrrolidin-1-yldiazenyl)benzoate |
|---|---|
| PubChem CID | 102231942 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | ethyl 3-[(E)-3-(4-chlorophenyl)-3-hydroxyprop-1-enyl]-4-(pyrrolidin-1-yldiazenyl)benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/N2CCCC2)c(/C=C/C(O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-2-29-22(28)18-7-11-20(24-25-26-13-3-4-14-26)17(15-18)8-12-21(27)16-5-9-19(23)10-6-16/h5-12,15,21,27H,2-4,13-14H2,1H3/b12-8+,25-24+ |
| InChIKey | NVLQENZQWWCAIT-AISJSYPQSA-N |
| XLogP | 5.36 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|