C17H23N3O5 — CID 67084631
ethyl 3-[4,5-dimethoxy-2-(pyrrolidin-1-yldiazenyl)phenyl]-3-oxopropanoate (PubChem CID 67084631) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is ethyl 3-[4,5-dimethoxy-2-(pyrrolidin-1-yldiazenyl)phenyl]-3-oxopropanoate.
| Compound Name | ethyl 3-[4,5-dimethoxy-2-(pyrrolidin-1-yldiazenyl)phenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 67084631 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | ethyl 3-[4,5-dimethoxy-2-(pyrrolidin-1-yldiazenyl)phenyl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc(OC)c(OC)cc1/N=N/N1CCCC1 |
| InChI | InChI=1S/C17H23N3O5/c1-4-25-17(22)11-14(21)12-9-15(23-2)16(24-3)10-13(12)18-19-20-7-5-6-8-20/h9-10H,4-8,11H2,1-3H3/b19-18+ |
| InChIKey | BLTDBKPRIAJJJU-VHEBQXMUSA-N |
| XLogP | 2.93 |
| TPSA | 89.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|