C15H22N2O5 — CID 21270415
methyl 3-(3-ethoxy-3-oxopropanoyl)-4-pyrrolidin-1-yl-2,5-dihydropyrrole-1-carboxylate (PubChem CID 21270415) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is methyl 3-(3-ethoxy-3-oxopropanoyl)-4-pyrrolidin-1-yl-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | methyl 3-(3-ethoxy-3-oxopropanoyl)-4-pyrrolidin-1-yl-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 21270415 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | methyl 3-(3-ethoxy-3-oxopropanoyl)-4-pyrrolidin-1-yl-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CCOC(=O)CC(=O)C1=C(N2CCCC2)CN(C(=O)OC)C1 |
| InChI | InChI=1S/C15H22N2O5/c1-3-22-14(19)8-13(18)11-9-17(15(20)21-2)10-12(11)16-6-4-5-7-16/h3-10H2,1-2H3 |
| InChIKey | STDAKXNHPBERQR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|