C20H26O10 — CID 11201129
3-O-[[4-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5-dimethoxyphenyl]methyl] 1-O-ethyl propanedioate (PubChem CID 11201129) has the molecular formula C20H26O10 and a molecular weight of 426.42 g/mol. Its IUPAC name is 3-O-[[4-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5-dimethoxyphenyl]methyl] 1-O-ethyl propanedioate.
| Compound Name | 3-O-[[4-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5-dimethoxyphenyl]methyl] 1-O-ethyl propanedioate |
|---|---|
| PubChem CID | 11201129 |
| Molecular Formula | C20H26O10 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 3-O-[[4-[(3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5-dimethoxyphenyl]methyl] 1-O-ethyl propanedioate |
| SMILES | CCOC(=O)CC(=O)OCc1cc(OC)c(COC(=O)CC(=O)OCC)cc1OC |
| InChI | InChI=1S/C20H26O10/c1-5-27-17(21)9-19(23)29-11-13-7-16(26-4)14(8-15(13)25-3)12-30-20(24)10-18(22)28-6-2/h7-8H,5-6,9-12H2,1-4H3 |
| InChIKey | YNYBEBWYRQXGDW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|