C20H24Br2O10 — CID 101230772
1-O-[[4-[(2-bromo-3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5-dimethoxyphenyl]methyl] 3-O-ethyl 2-bromopropanedioate (PubChem CID 101230772) has the molecular formula C20H24Br2O10 and a molecular weight of 584.21 g/mol. Its IUPAC name is 1-O-[[4-[(2-bromo-3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5-dimethoxyphenyl]methyl] 3-O-ethyl 2-bromopropanedioate.
| Compound Name | 1-O-[[4-[(2-bromo-3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5-dimethoxyphenyl]methyl] 3-O-ethyl 2-bromopropanedioate |
|---|---|
| PubChem CID | 101230772 |
| Molecular Formula | C20H24Br2O10 |
| Molecular Weight | 584.21 g/mol |
| Exact Mass | 581.97 |
| IUPAC Name | 1-O-[[4-[(2-bromo-3-ethoxy-3-oxopropanoyl)oxymethyl]-2,5-dimethoxyphenyl]methyl] 3-O-ethyl 2-bromopropanedioate |
| SMILES | CCOC(=O)C(Br)C(=O)OCc1cc(OC)c(COC(=O)C(Br)C(=O)OCC)cc1OC |
| InChI | InChI=1S/C20H24Br2O10/c1-5-29-17(23)15(21)19(25)31-9-11-7-14(28-4)12(8-13(11)27-3)10-32-20(26)16(22)18(24)30-6-2/h7-8,15-16H,5-6,9-10H2,1-4H3 |
| InChIKey | PWZHTRTXPXVYFB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|