C28H42O6 — CID 70677276
ethyl 2-[[4-(2-ethoxycarbonylhept-6-enyl)-2,5-dimethoxyphenyl]methyl]hept-6-enoate (PubChem CID 70677276) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is ethyl 2-[[4-(2-ethoxycarbonylhept-6-enyl)-2,5-dimethoxyphenyl]methyl]hept-6-enoate.
| Compound Name | ethyl 2-[[4-(2-ethoxycarbonylhept-6-enyl)-2,5-dimethoxyphenyl]methyl]hept-6-enoate |
|---|---|
| PubChem CID | 70677276 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | ethyl 2-[[4-(2-ethoxycarbonylhept-6-enyl)-2,5-dimethoxyphenyl]methyl]hept-6-enoate |
| SMILES | C=CCCCC(Cc1cc(OC)c(CC(CCCC=C)C(=O)OCC)cc1OC)C(=O)OCC |
| InChI | InChI=1S/C28H42O6/c1-7-11-13-15-21(27(29)33-9-3)17-23-19-26(32-6)24(20-25(23)31-5)18-22(16-14-12-8-2)28(30)34-10-4/h7-8,19-22H,1-2,9-18H2,3-6H3 |
| InChIKey | GUWRCRDUIOWENT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|