C17H25NO6 — CID 56651886
ethyl 3-[[1-(4-hydroxy-2,5-dimethoxyphenyl)-2-methylpropan-2-yl]amino]-3-oxopropanoate (PubChem CID 56651886) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is ethyl 3-[[1-(4-hydroxy-2,5-dimethoxyphenyl)-2-methylpropan-2-yl]amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[[1-(4-hydroxy-2,5-dimethoxyphenyl)-2-methylpropan-2-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 56651886 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | ethyl 3-[[1-(4-hydroxy-2,5-dimethoxyphenyl)-2-methylpropan-2-yl]amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NC(C)(C)Cc1cc(OC)c(O)cc1OC |
| InChI | InChI=1S/C17H25NO6/c1-6-24-16(21)9-15(20)18-17(2,3)10-11-7-14(23-5)12(19)8-13(11)22-4/h7-8,19H,6,9-10H2,1-5H3,(H,18,20) |
| InChIKey | STVOWNDAKMJOQS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|