C22H27N3O3 — CID 71485478
ethyl 3-[2-(1-hydroxypropyl)phenyl]-4-(pyrrolidin-1-yldiazenyl)benzoate (PubChem CID 71485478) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is ethyl 3-[2-(1-hydroxypropyl)phenyl]-4-(pyrrolidin-1-yldiazenyl)benzoate.
| Compound Name | ethyl 3-[2-(1-hydroxypropyl)phenyl]-4-(pyrrolidin-1-yldiazenyl)benzoate |
|---|---|
| PubChem CID | 71485478 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | ethyl 3-[2-(1-hydroxypropyl)phenyl]-4-(pyrrolidin-1-yldiazenyl)benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/N2CCCC2)c(-c2ccccc2C(O)CC)c1 |
| InChI | InChI=1S/C22H27N3O3/c1-3-21(26)18-10-6-5-9-17(18)19-15-16(22(27)28-4-2)11-12-20(19)23-24-25-13-7-8-14-25/h5-6,9-12,15,21,26H,3-4,7-8,13-14H2,1-2H3/b24-23+ |
| InChIKey | PVZKWSGGXGVRSX-WCWDXBQESA-N |
| XLogP | 5.07 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|