C26H32N6O4 — CID 23583787
ethyl 3-[5-ethoxycarbonyl-2-(pyrrolidin-1-yldiazenyl)phenyl]-4-(pyrrolidin-1-yldiazenyl)benzoate (PubChem CID 23583787) has the molecular formula C26H32N6O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is ethyl 3-[5-ethoxycarbonyl-2-(pyrrolidin-1-yldiazenyl)phenyl]-4-(pyrrolidin-1-yldiazenyl)benzoate.
| Compound Name | ethyl 3-[5-ethoxycarbonyl-2-(pyrrolidin-1-yldiazenyl)phenyl]-4-(pyrrolidin-1-yldiazenyl)benzoate |
|---|---|
| PubChem CID | 23583787 |
| Molecular Formula | C26H32N6O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | ethyl 3-[5-ethoxycarbonyl-2-(pyrrolidin-1-yldiazenyl)phenyl]-4-(pyrrolidin-1-yldiazenyl)benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/N2CCCC2)c(-c2cc(C(=O)OCC)ccc2/N=N/N2CCCC2)c1 |
| InChI | InChI=1S/C26H32N6O4/c1-3-35-25(33)19-9-11-23(27-29-31-13-5-6-14-31)21(17-19)22-18-20(26(34)36-4-2)10-12-24(22)28-30-32-15-7-8-16-32/h9-12,17-18H,3-8,13-16H2,1-2H3/b29-27+,30-28+ |
| InChIKey | GWXLJZPDISMIOB-QAVVBOBSSA-N |
| XLogP | 5.90 |
| TPSA | 108.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|