C26H33ClN2O3 — CID 70417120
ethyl 4-[1-amino-3-(5-chloro-2-piperidin-1-ylphenyl)-1-oxohexan-2-yl]benzoate (PubChem CID 70417120) has the molecular formula C26H33ClN2O3 and a molecular weight of 457.01 g/mol. Its IUPAC name is ethyl 4-[1-amino-3-(5-chloro-2-piperidin-1-ylphenyl)-1-oxohexan-2-yl]benzoate.
| Compound Name | ethyl 4-[1-amino-3-(5-chloro-2-piperidin-1-ylphenyl)-1-oxohexan-2-yl]benzoate |
|---|---|
| PubChem CID | 70417120 |
| Molecular Formula | C26H33ClN2O3 |
| Molecular Weight | 457.01 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | ethyl 4-[1-amino-3-(5-chloro-2-piperidin-1-ylphenyl)-1-oxohexan-2-yl]benzoate |
| SMILES | CCCC(c1cc(Cl)ccc1N1CCCCC1)C(C(N)=O)c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C26H33ClN2O3/c1-3-8-21(22-17-20(27)13-14-23(22)29-15-6-5-7-16-29)24(25(28)30)18-9-11-19(12-10-18)26(31)32-4-2/h9-14,17,21,24H,3-8,15-16H2,1-2H3,(H2,28,30) |
| InChIKey | KVBRPFRQAWTIAH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.01 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |