C24H29IN2O3 — CID 54555579
ethyl 4-[2-(ethylamino)-1-(5-iodo-2-piperidin-1-ylphenyl)-2-oxoethyl]benzoate (PubChem CID 54555579) has the molecular formula C24H29IN2O3 and a molecular weight of 520.41 g/mol. Its IUPAC name is ethyl 4-[2-(ethylamino)-1-(5-iodo-2-piperidin-1-ylphenyl)-2-oxoethyl]benzoate.
| Compound Name | ethyl 4-[2-(ethylamino)-1-(5-iodo-2-piperidin-1-ylphenyl)-2-oxoethyl]benzoate |
|---|---|
| PubChem CID | 54555579 |
| Molecular Formula | C24H29IN2O3 |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | ethyl 4-[2-(ethylamino)-1-(5-iodo-2-piperidin-1-ylphenyl)-2-oxoethyl]benzoate |
| SMILES | CCNC(=O)C(c1ccc(C(=O)OCC)cc1)c1cc(I)ccc1N1CCCCC1 |
| InChI | InChI=1S/C24H29IN2O3/c1-3-26-23(28)22(17-8-10-18(11-9-17)24(29)30-4-2)20-16-19(25)12-13-21(20)27-14-6-5-7-15-27/h8-13,16,22H,3-7,14-15H2,1-2H3,(H,26,28) |
| InChIKey | ZMYDULKTSSAUPT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|