C22H25N2NaO3 — CID 70417455
sodium 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate (PubChem CID 70417455) has the molecular formula C22H25N2NaO3 and a molecular weight of 388.44 g/mol. Its IUPAC name is sodium 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate.
| Compound Name | sodium 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate |
|---|---|
| PubChem CID | 70417455 |
| Molecular Formula | C22H25N2NaO3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | sodium 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate |
| SMILES | CCNC(=O)C(c1ccc(C(=O)[O-])cc1)c1ccccc1N1CCCCC1.[Na+] |
| InChI | InChI=1S/C22H26N2O3.Na/c1-2-23-21(25)20(16-10-12-17(13-11-16)22(26)27)18-8-4-5-9-19(18)24-14-6-3-7-15-24;/h4-5,8-13,20H,2-3,6-7,14-15H2,1H3,(H,23,25)(H,26,27);/q;+1/p-1 |
| InChIKey | GISYMRTZOPBYQQ-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |