C24H29N3O4 — CID 70417583
4-[1-(5-acetamido-2-piperidin-1-ylphenyl)-2-(ethylamino)-2-oxoethyl]benzoic acid (PubChem CID 70417583) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 4-[1-(5-acetamido-2-piperidin-1-ylphenyl)-2-(ethylamino)-2-oxoethyl]benzoic acid.
| Compound Name | 4-[1-(5-acetamido-2-piperidin-1-ylphenyl)-2-(ethylamino)-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 70417583 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 4-[1-(5-acetamido-2-piperidin-1-ylphenyl)-2-(ethylamino)-2-oxoethyl]benzoic acid |
| SMILES | CCNC(=O)C(c1ccc(C(=O)O)cc1)c1cc(NC(C)=O)ccc1N1CCCCC1 |
| InChI | InChI=1S/C24H29N3O4/c1-3-25-23(29)22(17-7-9-18(10-8-17)24(30)31)20-15-19(26-16(2)28)11-12-21(20)27-13-5-4-6-14-27/h7-12,15,22H,3-6,13-14H2,1-2H3,(H,25,29)(H,26,28)(H,30,31) |
| InChIKey | IGAMOYUNNFOQSU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|