C29H31FN2O3 — CID 13281046
ethyl 4-[2-[[(4-fluorophenyl)-(2-piperidin-1-ylphenyl)methyl]amino]-2-oxoethyl]benzoate (PubChem CID 13281046) has the molecular formula C29H31FN2O3 and a molecular weight of 474.58 g/mol. Its IUPAC name is ethyl 4-[2-[[(4-fluorophenyl)-(2-piperidin-1-ylphenyl)methyl]amino]-2-oxoethyl]benzoate.
| Compound Name | ethyl 4-[2-[[(4-fluorophenyl)-(2-piperidin-1-ylphenyl)methyl]amino]-2-oxoethyl]benzoate |
|---|---|
| PubChem CID | 13281046 |
| Molecular Formula | C29H31FN2O3 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | ethyl 4-[2-[[(4-fluorophenyl)-(2-piperidin-1-ylphenyl)methyl]amino]-2-oxoethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CC(=O)NC(c2ccc(F)cc2)c2ccccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C29H31FN2O3/c1-2-35-29(34)23-12-10-21(11-13-23)20-27(33)31-28(22-14-16-24(30)17-15-22)25-8-4-5-9-26(25)32-18-6-3-7-19-32/h4-5,8-17,28H,2-3,6-7,18-20H2,1H3,(H,31,33) |
| InChIKey | AMZVIFZPEILILG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |