C31H34N2O3 — CID 54215349
ethyl 3-[4-[2-oxo-2-[[phenyl-(2-piperidin-1-ylphenyl)methyl]amino]ethyl]phenyl]prop-2-enoate (PubChem CID 54215349) has the molecular formula C31H34N2O3 and a molecular weight of 482.62 g/mol. Its IUPAC name is ethyl 3-[4-[2-oxo-2-[[phenyl-(2-piperidin-1-ylphenyl)methyl]amino]ethyl]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[2-oxo-2-[[phenyl-(2-piperidin-1-ylphenyl)methyl]amino]ethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 54215349 |
| Molecular Formula | C31H34N2O3 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | ethyl 3-[4-[2-oxo-2-[[phenyl-(2-piperidin-1-ylphenyl)methyl]amino]ethyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(CC(=O)NC(c2ccccc2)c2ccccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C31H34N2O3/c1-2-36-30(35)20-19-24-15-17-25(18-16-24)23-29(34)32-31(26-11-5-3-6-12-26)27-13-7-8-14-28(27)33-21-9-4-10-22-33/h3,5-8,11-20,31H,2,4,9-10,21-23H2,1H3,(H,32,34) |
| InChIKey | PYUAEVFUIMXXNT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|