C25H32N2O3 — CID 10501610
4-[2-[1-[2-(azonan-1-yl)phenyl]ethylamino]-2-oxoethyl]benzoic acid (PubChem CID 10501610) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 4-[2-[1-[2-(azonan-1-yl)phenyl]ethylamino]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[2-[1-[2-(azonan-1-yl)phenyl]ethylamino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 10501610 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 4-[2-[1-[2-(azonan-1-yl)phenyl]ethylamino]-2-oxoethyl]benzoic acid |
| SMILES | CC(NC(=O)Cc1ccc(C(=O)O)cc1)c1ccccc1N1CCCCCCCC1 |
| InChI | InChI=1S/C25H32N2O3/c1-19(26-24(28)18-20-12-14-21(15-13-20)25(29)30)22-10-6-7-11-23(22)27-16-8-4-2-3-5-9-17-27/h6-7,10-15,19H,2-5,8-9,16-18H2,1H3,(H,26,28)(H,29,30) |
| InChIKey | LJFPXOATIGPVGQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |