C26H33ClN2O3 — CID 11798080
methyl 4-[2-[1-[2-(azonan-1-yl)-5-chlorophenyl]ethylamino]-2-oxoethyl]benzoate (PubChem CID 11798080) has the molecular formula C26H33ClN2O3 and a molecular weight of 457.01 g/mol. Its IUPAC name is methyl 4-[2-[1-[2-(azonan-1-yl)-5-chlorophenyl]ethylamino]-2-oxoethyl]benzoate.
| Compound Name | methyl 4-[2-[1-[2-(azonan-1-yl)-5-chlorophenyl]ethylamino]-2-oxoethyl]benzoate |
|---|---|
| PubChem CID | 11798080 |
| Molecular Formula | C26H33ClN2O3 |
| Molecular Weight | 457.01 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | methyl 4-[2-[1-[2-(azonan-1-yl)-5-chlorophenyl]ethylamino]-2-oxoethyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(=O)NC(C)c2cc(Cl)ccc2N2CCCCCCCC2)cc1 |
| InChI | InChI=1S/C26H33ClN2O3/c1-19(28-25(30)17-20-9-11-21(12-10-20)26(31)32-2)23-18-22(27)13-14-24(23)29-15-7-5-3-4-6-8-16-29/h9-14,18-19H,3-8,15-17H2,1-2H3,(H,28,30) |
| InChIKey | GPVCEEOEDINXIM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.01 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |