C31H36N2O4 — CID 70418244
ethyl 4-[2-oxo-2-[1-(5-phenylmethoxy-2-piperidin-1-ylphenyl)ethylamino]ethyl]benzoate (PubChem CID 70418244) has the molecular formula C31H36N2O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is ethyl 4-[2-oxo-2-[1-(5-phenylmethoxy-2-piperidin-1-ylphenyl)ethylamino]ethyl]benzoate.
| Compound Name | ethyl 4-[2-oxo-2-[1-(5-phenylmethoxy-2-piperidin-1-ylphenyl)ethylamino]ethyl]benzoate |
|---|---|
| PubChem CID | 70418244 |
| Molecular Formula | C31H36N2O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | ethyl 4-[2-oxo-2-[1-(5-phenylmethoxy-2-piperidin-1-ylphenyl)ethylamino]ethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CC(=O)NC(C)c2cc(OCc3ccccc3)ccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C31H36N2O4/c1-3-36-31(35)26-14-12-24(13-15-26)20-30(34)32-23(2)28-21-27(37-22-25-10-6-4-7-11-25)16-17-29(28)33-18-8-5-9-19-33/h4,6-7,10-17,21,23H,3,5,8-9,18-20,22H2,1-2H3,(H,32,34) |
| InChIKey | MHQBOVBZXFYDAG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|