C29H40N2O4 — CID 21261792
ethyl 4-[2-[1-[2-(azepan-1-yl)phenyl]butylamino]-2-oxoethyl]-2-ethoxybenzoate (PubChem CID 21261792) has the molecular formula C29H40N2O4 and a molecular weight of 480.65 g/mol. Its IUPAC name is ethyl 4-[2-[1-[2-(azepan-1-yl)phenyl]butylamino]-2-oxoethyl]-2-ethoxybenzoate.
| Compound Name | ethyl 4-[2-[1-[2-(azepan-1-yl)phenyl]butylamino]-2-oxoethyl]-2-ethoxybenzoate |
|---|---|
| PubChem CID | 21261792 |
| Molecular Formula | C29H40N2O4 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | ethyl 4-[2-[1-[2-(azepan-1-yl)phenyl]butylamino]-2-oxoethyl]-2-ethoxybenzoate |
| SMILES | CCCC(NC(=O)Cc1ccc(C(=O)OCC)c(OCC)c1)c1ccccc1N1CCCCCC1 |
| InChI | InChI=1S/C29H40N2O4/c1-4-13-25(23-14-9-10-15-26(23)31-18-11-7-8-12-19-31)30-28(32)21-22-16-17-24(29(33)35-6-3)27(20-22)34-5-2/h9-10,14-17,20,25H,4-8,11-13,18-19,21H2,1-3H3,(H,30,32) |
| InChIKey | GMMMMCYQGNQOIS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |