C35H43N3O7 — CID 118726958
[3-(nitrooxymethyl)phenyl]methyl 2-ethoxy-4-[2-[[(1S)-3-methyl-1-(2-piperidin-1-ylphenyl)butyl]amino]-2-oxoethyl]benzoate (PubChem CID 118726958) has the molecular formula C35H43N3O7 and a molecular weight of 617.74 g/mol. Its IUPAC name is [3-(nitrooxymethyl)phenyl]methyl 2-ethoxy-4-[2-[[(1S)-3-methyl-1-(2-piperidin-1-ylphenyl)butyl]amino]-2-oxoethyl]benzoate.
| Compound Name | [3-(nitrooxymethyl)phenyl]methyl 2-ethoxy-4-[2-[[(1S)-3-methyl-1-(2-piperidin-1-ylphenyl)butyl]amino]-2-oxoethyl]benzoate |
|---|---|
| PubChem CID | 118726958 |
| Molecular Formula | C35H43N3O7 |
| Molecular Weight | 617.74 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | [3-(nitrooxymethyl)phenyl]methyl 2-ethoxy-4-[2-[[(1S)-3-methyl-1-(2-piperidin-1-ylphenyl)butyl]amino]-2-oxoethyl]benzoate |
| SMILES | CCOc1cc(CC(=O)N[C@@H](CC(C)C)c2ccccc2N2CCCCC2)ccc1C(=O)OCc1cccc(CO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C35H43N3O7/c1-4-43-33-21-26(15-16-30(33)35(40)44-23-27-11-10-12-28(20-27)24-45-38(41)42)22-34(39)36-31(19-25(2)3)29-13-6-7-14-32(29)37-17-8-5-9-18-37/h6-7,10-16,20-21,25,31H,4-5,8-9,17-19,22-24H2,1-3H3,(H,36,39)/t31-/m0/s1 |
| InChIKey | IHHPGNGGKUXIEJ-HKBQPEDESA-N |
| XLogP | 6.59 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.74 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|