C29H40N2O5 — CID 152593308
ethyl 2-ethoxy-4-[2-[[3-ethoxy-1-(2-piperidin-1-ylphenyl)propyl]amino]-2-oxoethyl]benzoate (PubChem CID 152593308) has the molecular formula C29H40N2O5 and a molecular weight of 496.65 g/mol. Its IUPAC name is ethyl 2-ethoxy-4-[2-[[3-ethoxy-1-(2-piperidin-1-ylphenyl)propyl]amino]-2-oxoethyl]benzoate.
| Compound Name | ethyl 2-ethoxy-4-[2-[[3-ethoxy-1-(2-piperidin-1-ylphenyl)propyl]amino]-2-oxoethyl]benzoate |
|---|---|
| PubChem CID | 152593308 |
| Molecular Formula | C29H40N2O5 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | ethyl 2-ethoxy-4-[2-[[3-ethoxy-1-(2-piperidin-1-ylphenyl)propyl]amino]-2-oxoethyl]benzoate |
| SMILES | CCOCCC(NC(=O)Cc1ccc(C(=O)OCC)c(OCC)c1)c1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C29H40N2O5/c1-4-34-19-16-25(23-12-8-9-13-26(23)31-17-10-7-11-18-31)30-28(32)21-22-14-15-24(29(33)36-6-3)27(20-22)35-5-2/h8-9,12-15,20,25H,4-7,10-11,16-19,21H2,1-3H3,(H,30,32) |
| InChIKey | YVXWOQXRZVDPJW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|