C29H38N2O6 — CID 58625223
3-ethoxy-3-oxo-2-[4-[2-oxo-2-[1-(2-piperidin-1-ylphenyl)pentylamino]ethyl]phenoxy]propanoic acid (PubChem CID 58625223) has the molecular formula C29H38N2O6 and a molecular weight of 510.63 g/mol. Its IUPAC name is 3-ethoxy-3-oxo-2-[4-[2-oxo-2-[1-(2-piperidin-1-ylphenyl)pentylamino]ethyl]phenoxy]propanoic acid.
| Compound Name | 3-ethoxy-3-oxo-2-[4-[2-oxo-2-[1-(2-piperidin-1-ylphenyl)pentylamino]ethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 58625223 |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 3-ethoxy-3-oxo-2-[4-[2-oxo-2-[1-(2-piperidin-1-ylphenyl)pentylamino]ethyl]phenoxy]propanoic acid |
| SMILES | CCCCC(NC(=O)Cc1ccc(OC(C(=O)O)C(=O)OCC)cc1)c1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C29H38N2O6/c1-3-5-12-24(23-11-7-8-13-25(23)31-18-9-6-10-19-31)30-26(32)20-21-14-16-22(17-15-21)37-27(28(33)34)29(35)36-4-2/h7-8,11,13-17,24,27H,3-6,9-10,12,18-20H2,1-2H3,(H,30,32)(H,33,34) |
| InChIKey | MUHKVPCFBUUXJV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|