C22H25NO5 — CID 10619981
4-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]oxane-4-carboxylic acid (PubChem CID 10619981) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 4-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]oxane-4-carboxylic acid.
| Compound Name | 4-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 10619981 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 4-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]oxane-4-carboxylic acid |
| SMILES | Cc1cc(C)cc(NC(=O)Cc2ccc(OC3(C(=O)O)CCOCC3)cc2)c1 |
| InChI | InChI=1S/C22H25NO5/c1-15-11-16(2)13-18(12-15)23-20(24)14-17-3-5-19(6-4-17)28-22(21(25)26)7-9-27-10-8-22/h3-6,11-13H,7-10,14H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | HTWINGIVVREWLA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |