C24H23NO4 — CID 20783005
2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-phenylacetic acid (PubChem CID 20783005) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-phenylacetic acid.
| Compound Name | 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-phenylacetic acid |
|---|---|
| PubChem CID | 20783005 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-phenylacetic acid |
| SMILES | Cc1cc(C)cc(NC(=O)Cc2ccc(OC(C(=O)O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H23NO4/c1-16-12-17(2)14-20(13-16)25-22(26)15-18-8-10-21(11-9-18)29-23(24(27)28)19-6-4-3-5-7-19/h3-14,23H,15H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | HSUCQZZMXIVPIO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |