C20H23NNaO4 — CID 6331796
CID 6331796 (PubChem CID 6331796) has the molecular formula C20H23NNaO4 and a molecular weight of 364.40 g/mol.
| Compound Name | CID 6331796 |
|---|---|
| PubChem CID | 6331796 |
| Molecular Formula | C20H23NNaO4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)cc(NC(=O)Cc2ccc(OC(C)(C)C(=O)O)cc2)c1.[Na] |
| InChI | InChI=1S/C20H23NO4.Na/c1-13-9-14(2)11-16(10-13)21-18(22)12-15-5-7-17(8-6-15)25-20(3,4)19(23)24;/h5-11H,12H2,1-4H3,(H,21,22)(H,23,24); |
| InChIKey | FRALEEHVNHZMMR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |