C20H20N2O4 — CID 175488495
2-[4-[2-(1H-indol-5-ylamino)-2-oxoethyl]phenoxy]-2-methylpropanoic acid (PubChem CID 175488495) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[4-[2-(1H-indol-5-ylamino)-2-oxoethyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-(1H-indol-5-ylamino)-2-oxoethyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175488495 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-[4-[2-(1H-indol-5-ylamino)-2-oxoethyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(CC(=O)Nc2ccc3[nH]ccc3c2)cc1)C(=O)O |
| InChI | InChI=1S/C20H20N2O4/c1-20(2,19(24)25)26-16-6-3-13(4-7-16)11-18(23)22-15-5-8-17-14(12-15)9-10-21-17/h3-10,12,21H,11H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | JKPBXQNMGVETRM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |