C24H32N4O6 — CID 118195895
(Z)-diethylamino-[2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-methylpropanoyl]peroxyimino-oxidoazanium (PubChem CID 118195895) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is (Z)-diethylamino-[2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-methylpropanoyl]peroxyimino-oxidoazanium.
| Compound Name | (Z)-diethylamino-[2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-methylpropanoyl]peroxyimino-oxidoazanium |
|---|---|
| PubChem CID | 118195895 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (Z)-diethylamino-[2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-methylpropanoyl]peroxyimino-oxidoazanium |
| SMILES | CCN(CC)/[N+]([O-])=N/OOC(=O)C(C)(C)Oc1ccc(CC(=O)Nc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C24H32N4O6/c1-7-27(8-2)28(31)26-34-33-23(30)24(5,6)32-21-11-9-19(10-12-21)16-22(29)25-20-14-17(3)13-18(4)15-20/h9-15H,7-8,16H2,1-6H3,(H,25,29)/b28-26- |
| InChIKey | NBLMMQVQOJYRHA-SGEDCAFJSA-N |
| XLogP | 4.25 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|