C27H35N2NaO4 — CID 159935064
sodium 2-ethoxy-4-[2-[1-(2-methyl-6-piperidin-1-ylphenyl)butylamino]-2-oxoethyl]benzoate (PubChem CID 159935064) has the molecular formula C27H35N2NaO4 and a molecular weight of 474.58 g/mol. Its IUPAC name is sodium 2-ethoxy-4-[2-[1-(2-methyl-6-piperidin-1-ylphenyl)butylamino]-2-oxoethyl]benzoate.
| Compound Name | sodium 2-ethoxy-4-[2-[1-(2-methyl-6-piperidin-1-ylphenyl)butylamino]-2-oxoethyl]benzoate |
|---|---|
| PubChem CID | 159935064 |
| Molecular Formula | C27H35N2NaO4 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | sodium 2-ethoxy-4-[2-[1-(2-methyl-6-piperidin-1-ylphenyl)butylamino]-2-oxoethyl]benzoate |
| SMILES | CCCC(NC(=O)Cc1ccc(C(=O)[O-])c(OCC)c1)c1c(C)cccc1N1CCCCC1.[Na+] |
| InChI | InChI=1S/C27H36N2O4.Na/c1-4-10-22(26-19(3)11-9-12-23(26)29-15-7-6-8-16-29)28-25(30)18-20-13-14-21(27(31)32)24(17-20)33-5-2;/h9,11-14,17,22H,4-8,10,15-16,18H2,1-3H3,(H,28,30)(H,31,32);/q;+1/p-1 |
| InChIKey | OADIJYCFJDBFNR-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |