C14H18ClNO3 — CID 117456058
methyl 2-(5-chloro-2-piperidin-1-ylphenyl)-2-hydroxyacetate (PubChem CID 117456058) has the molecular formula C14H18ClNO3 and a molecular weight of 283.76 g/mol. Its IUPAC name is methyl 2-(5-chloro-2-piperidin-1-ylphenyl)-2-hydroxyacetate.
| Compound Name | methyl 2-(5-chloro-2-piperidin-1-ylphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117456058 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | methyl 2-(5-chloro-2-piperidin-1-ylphenyl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1cc(Cl)ccc1N1CCCCC1 |
| InChI | InChI=1S/C14H18ClNO3/c1-19-14(18)13(17)11-9-10(15)5-6-12(11)16-7-3-2-4-8-16/h5-6,9,13,17H,2-4,7-8H2,1H3 |
| InChIKey | KDPUOQZAHUCZSW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |