C14H19ClN2O3 — CID 117481301
methyl 2-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-hydroxyacetate (PubChem CID 117481301) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is methyl 2-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-hydroxyacetate.
| Compound Name | methyl 2-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 117481301 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | methyl 2-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1ccc(N2CCN(C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O3/c1-16-5-7-17(8-6-16)12-4-3-10(9-11(12)15)13(18)14(19)20-2/h3-4,9,13,18H,5-8H2,1-2H3 |
| InChIKey | MOMBATGUKCUFFR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|