C30H35N3O3S — CID 135263084
2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-[phenyl-(2-piperidin-1-ylphenyl)methyl]acetamide (PubChem CID 135263084) has the molecular formula C30H35N3O3S and a molecular weight of 517.70 g/mol. Its IUPAC name is 2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-[phenyl-(2-piperidin-1-ylphenyl)methyl]acetamide.
| Compound Name | 2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-[phenyl-(2-piperidin-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 135263084 |
| Molecular Formula | C30H35N3O3S |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-[phenyl-(2-piperidin-1-ylphenyl)methyl]acetamide |
| SMILES | O=C(Cc1ccc(N2CCS(=O)(=O)CC2)cc1)NC(c1ccccc1)c1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C30H35N3O3S/c34-29(23-24-13-15-26(16-14-24)32-19-21-37(35,36)22-20-32)31-30(25-9-3-1-4-10-25)27-11-5-6-12-28(27)33-17-7-2-8-18-33/h1,3-6,9-16,30H,2,7-8,17-23H2,(H,31,34) |
| InChIKey | DEATYRMAJHDKOP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|