C26H27BrN2O3S — CID 135262987
N-[(2-bromo-4-methylphenyl)-phenylmethyl]-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]acetamide (PubChem CID 135262987) has the molecular formula C26H27BrN2O3S and a molecular weight of 527.48 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)-phenylmethyl]-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]acetamide.
| Compound Name | N-[(2-bromo-4-methylphenyl)-phenylmethyl]-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 135262987 |
| Molecular Formula | C26H27BrN2O3S |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)-phenylmethyl]-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]acetamide |
| SMILES | Cc1ccc(C(NC(=O)Cc2ccc(N3CCS(=O)(=O)CC3)cc2)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C26H27BrN2O3S/c1-19-7-12-23(24(27)17-19)26(21-5-3-2-4-6-21)28-25(30)18-20-8-10-22(11-9-20)29-13-15-33(31,32)16-14-29/h2-12,17,26H,13-16,18H2,1H3,(H,28,30) |
| InChIKey | IORQTJTZXROVKM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|