C22H21F3N4O3S — CID 157037088
3-(methylsulfonimidoyl)propyl 2-methyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]indole-7-carboxylate (PubChem CID 157037088) has the molecular formula C22H21F3N4O3S and a molecular weight of 478.50 g/mol. Its IUPAC name is 3-(methylsulfonimidoyl)propyl 2-methyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]indole-7-carboxylate.
| Compound Name | 3-(methylsulfonimidoyl)propyl 2-methyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 157037088 |
| Molecular Formula | C22H21F3N4O3S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 3-(methylsulfonimidoyl)propyl 2-methyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]indole-7-carboxylate |
| SMILES | [H]N=S(C)(=O)CCCOC(=O)c1ccc2c(c1)c1cn(C)nc1n2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H21F3N4O3S/c1-28-13-18-17-12-14(21(30)32-10-3-11-33(2,26)31)4-9-19(17)29(20(18)27-28)16-7-5-15(6-8-16)22(23,24)25/h4-9,12-13,26H,3,10-11H2,1-2H3 |
| InChIKey | AXHHXDDDNAZPQT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 89.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|