C19H16ClN3O2 — CID 157037273
ethyl 4-(4-chlorophenyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylate (PubChem CID 157037273) has the molecular formula C19H16ClN3O2 and a molecular weight of 353.81 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 157037273 |
| Molecular Formula | C19H16ClN3O2 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-methylpyrazolo[3,4-b]indole-7-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c1cn(C)nc1n2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN3O2/c1-3-25-19(24)12-4-9-17-15(10-12)16-11-22(2)21-18(16)23(17)14-7-5-13(20)6-8-14/h4-11H,3H2,1-2H3 |
| InChIKey | AAICCTPMJSFWIV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |