C17H13BF3N3O2 — CID 157037680
[2-methyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]indol-7-yl]boronic acid (PubChem CID 157037680) has the molecular formula C17H13BF3N3O2 and a molecular weight of 359.12 g/mol. Its IUPAC name is [2-methyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]indol-7-yl]boronic acid.
| Compound Name | [2-methyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]indol-7-yl]boronic acid |
|---|---|
| PubChem CID | 157037680 |
| Molecular Formula | C17H13BF3N3O2 |
| Molecular Weight | 359.12 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [2-methyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]indol-7-yl]boronic acid |
| SMILES | Cn1cc2c3cc(B(O)O)ccc3n(-c3ccc(C(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C17H13BF3N3O2/c1-23-9-14-13-8-11(18(25)26)4-7-15(13)24(16(14)22-23)12-5-2-10(3-6-12)17(19,20)21/h2-9,25-26H,1H3 |
| InChIKey | BFUYWYROWNCBSW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.12 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|