C21H14F3NO2 — CID 162680935
5-methyl-9-[4-(trifluoromethyl)phenyl]carbazole-3-carboxylic acid (PubChem CID 162680935) has the molecular formula C21H14F3NO2 and a molecular weight of 369.34 g/mol. Its IUPAC name is 5-methyl-9-[4-(trifluoromethyl)phenyl]carbazole-3-carboxylic acid.
| Compound Name | 5-methyl-9-[4-(trifluoromethyl)phenyl]carbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 162680935 |
| Molecular Formula | C21H14F3NO2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 5-methyl-9-[4-(trifluoromethyl)phenyl]carbazole-3-carboxylic acid |
| SMILES | Cc1cccc2c1c1cc(C(=O)O)ccc1n2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H14F3NO2/c1-12-3-2-4-18-19(12)16-11-13(20(26)27)5-10-17(16)25(18)15-8-6-14(7-9-15)21(22,23)24/h2-11H,1H3,(H,26,27) |
| InChIKey | ZASZNWZPUJDMNA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |